C18H26N6O9 — CID 18246672
2-[[2-[2-[(2-amino-3-carboxypropanoyl)amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18246672) has the molecular formula C18H26N6O9 and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-carboxypropanoyl)amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-carboxypropanoyl)amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18246672 |
| Molecular Formula | C18H26N6O9 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-carboxypropanoyl)amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanedioic acid |
| SMILES | CC(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26N6O9/c1-8(22-16(30)10(19)5-14(27)28)15(29)24-12(4-9-6-20-7-21-9)17(31)23-11(18(32)33)2-3-13(25)26/h6-8,10-12H,2-5,19H2,1H3,(H,20,21)(H,22,30)(H,23,31)(H,24,29)(H,25,26)(H,27,28)(H,32,33) |
| InChIKey | PSKZRVBJALHQSS-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 253.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |