C19H26N6O11 — CID 10279358
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 10279358) has the molecular formula C19H26N6O11 and a molecular weight of 514.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10279358 |
| Molecular Formula | C19H26N6O11 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N6O11/c20-9(4-14(28)29)16(32)23-10(1-2-13(26)27)17(33)24-11(3-8-6-21-7-22-8)18(34)25-12(19(35)36)5-15(30)31/h6-7,9-12H,1-5,20H2,(H,21,22)(H,23,32)(H,24,33)(H,25,34)(H,26,27)(H,28,29)(H,30,31)(H,35,36)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | IKRZHJPINHSUQX-BJDJZHNGSA-N |
| XLogP | -3.37 |
| TPSA | 291.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |