C18H26N6O9S — CID 18494332
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 18494332) has the molecular formula C18H26N6O9S and a molecular weight of 502.51 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18494332 |
| Molecular Formula | C18H26N6O9S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26N6O9S/c19-9(3-8-5-20-7-21-8)15(29)24-12(6-34)17(31)22-10(1-2-13(25)26)16(30)23-11(18(32)33)4-14(27)28/h5,7,9-12,34H,1-4,6,19H2,(H,20,21)(H,22,31)(H,23,30)(H,24,29)(H,25,26)(H,27,28)(H,32,33) |
| InChIKey | OCORQAZDAMEFAZ-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 253.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|