C14H21N5O6S — CID 145455802
(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 145455802) has the molecular formula C14H21N5O6S and a molecular weight of 387.42 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 145455802 |
| Molecular Formula | C14H21N5O6S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H21N5O6S/c15-8(3-7-4-16-6-17-7)12(22)19-10(5-26)13(23)18-9(14(24)25)1-2-11(20)21/h4,6,8-10,26H,1-3,5,15H2,(H,16,17)(H,18,23)(H,19,22)(H,20,21)(H,24,25)/t8-,9-,10-/m0/s1 |
| InChIKey | CYHWWHKRCKHYGQ-GUBZILKMSA-N |
| XLogP | -1.87 |
| TPSA | 187.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|