C18H28N8O7S — CID 18493515
5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18493515) has the molecular formula C18H28N8O7S and a molecular weight of 500.54 g/mol. Its IUPAC name is 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18493515 |
| Molecular Formula | C18H28N8O7S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CS)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C18H28N8O7S/c19-9(3-8-5-22-7-23-8)15(29)25-11(4-14(21)28)16(30)26-12(6-34)17(31)24-10(18(32)33)1-2-13(20)27/h5,7,9-12,34H,1-4,6,19H2,(H2,20,27)(H2,21,28)(H,22,23)(H,24,31)(H,25,29)(H,26,30)(H,32,33) |
| InChIKey | CAZVRZHDWKTGCU-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 265.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|