C20H30N8O9 — CID 18495071
2-[[4-amino-2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid (PubChem CID 18495071) has the molecular formula C20H30N8O9 and a molecular weight of 526.51 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18495071 |
| Molecular Formula | C20H30N8O9 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H30N8O9/c21-10(5-9-7-24-8-25-9)17(33)26-11(1-3-14(22)29)18(34)28-13(6-15(23)30)19(35)27-12(20(36)37)2-4-16(31)32/h7-8,10-13H,1-6,21H2,(H2,22,29)(H2,23,30)(H,24,25)(H,26,33)(H,27,35)(H,28,34)(H,31,32)(H,36,37) |
| InChIKey | PKVYHGVERAZEOB-UHFFFAOYSA-N |
| XLogP | -4.18 |
| TPSA | 302.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |