C19H29N7O8S — CID 18494335
5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 18494335) has the molecular formula C19H29N7O8S and a molecular weight of 515.55 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18494335 |
| Molecular Formula | C19H29N7O8S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CCC(=O)O)NC(=O)C(CS)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H29N7O8S/c20-10(5-9-6-22-8-23-9)16(30)26-13(7-35)18(32)24-11(2-4-15(28)29)17(31)25-12(19(33)34)1-3-14(21)27/h6,8,10-13,35H,1-5,7,20H2,(H2,21,27)(H,22,23)(H,24,32)(H,25,31)(H,26,30)(H,28,29)(H,33,34) |
| InChIKey | FATDRHSZQSPPRJ-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 259.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|