C16H24N6O8S — CID 18494531
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 18494531) has the molecular formula C16H24N6O8S and a molecular weight of 460.47 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18494531 |
| Molecular Formula | C16H24N6O8S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N6O8S/c17-8(1-7-3-18-6-19-7)13(26)22-11(5-31)15(28)21-10(4-23)14(27)20-9(16(29)30)2-12(24)25/h3,6,8-11,23,31H,1-2,4-5,17H2,(H,18,19)(H,20,27)(H,21,28)(H,22,26)(H,24,25)(H,29,30) |
| InChIKey | GRJUWDRPCYJFSL-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|