C16H26N8O6S — CID 87814303
(2S)-2-[[(2R)-2-[[(2S)-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanediamide (PubChem CID 87814303) has the molecular formula C16H26N8O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanediamide.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanediamide |
|---|---|
| PubChem CID | 87814303 |
| Molecular Formula | C16H26N8O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]butanediamide |
| SMILES | NC(=O)C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CO)NC(=O)C(N)Cc1cnc[nH]1)C(N)=O |
| InChI | InChI=1S/C16H26N8O6S/c17-8(1-7-3-20-6-21-7)14(28)23-10(4-25)15(29)24-11(5-31)16(30)22-9(13(19)27)2-12(18)26/h3,6,8-11,25,31H,1-2,4-5,17H2,(H2,18,26)(H2,19,27)(H,20,21)(H,22,30)(H,23,28)(H,24,29)/t8?,9-,10-,11-/m0/s1 |
| InChIKey | KXDKLMYCYPTEHU-KQFSYOIOSA-N |
| XLogP | -4.98 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | -4.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|