C18H24N6O11 — CID 18247865
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 18247865) has the molecular formula C18H24N6O11 and a molecular weight of 500.42 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18247865 |
| Molecular Formula | C18H24N6O11 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H24N6O11/c19-8(2-12(25)26)15(31)22-10(3-13(27)28)17(33)23-9(1-7-5-20-6-21-7)16(32)24-11(18(34)35)4-14(29)30/h5-6,8-11H,1-4,19H2,(H,20,21)(H,22,31)(H,23,33)(H,24,32)(H,25,26)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | SXRXNNXUVHMPSK-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 291.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |