C21H32N6O9 — CID 18249882
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid (PubChem CID 18249882) has the molecular formula C21H32N6O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18249882 |
| Molecular Formula | C21H32N6O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H32N6O9/c1-3-10(2)17(20(34)25-13(21(35)36)4-5-15(28)29)27-19(33)14(6-11-8-23-9-24-11)26-18(32)12(22)7-16(30)31/h8-10,12-14,17H,3-7,22H2,1-2H3,(H,23,24)(H,25,34)(H,26,32)(H,27,33)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | MRCQDYKEFKTNKV-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 253.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |