C19H28N6O10 — CID 18252997
4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18252997) has the molecular formula C19H28N6O10 and a molecular weight of 500.47 g/mol. Its IUPAC name is 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18252997 |
| Molecular Formula | C19H28N6O10 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H28N6O10/c1-8(26)15(25-16(31)10(20)5-14(29)30)18(33)23-11(2-3-13(27)28)17(32)24-12(19(34)35)4-9-6-21-7-22-9/h6-8,10-12,15,26H,2-5,20H2,1H3,(H,21,22)(H,23,33)(H,24,32)(H,25,31)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | OZFPKGYOLNZKHM-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 274.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |