C17H26N6O9 — CID 18253064
3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18253064) has the molecular formula C17H26N6O9 and a molecular weight of 458.43 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18253064 |
| Molecular Formula | C17H26N6O9 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C17H26N6O9/c1-7(25)13(23-14(28)9(18)3-12(26)27)16(30)21-10(2-8-4-19-6-20-8)15(29)22-11(5-24)17(31)32/h4,6-7,9-11,13,24-25H,2-3,5,18H2,1H3,(H,19,20)(H,21,30)(H,22,29)(H,23,28)(H,26,27)(H,31,32) |
| InChIKey | DXCOCOSWGXXZQG-UHFFFAOYSA-N |
| XLogP | -4.33 |
| TPSA | 257.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |