C17H26N6O8S — CID 18248276
3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18248276) has the molecular formula C17H26N6O8S and a molecular weight of 474.50 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18248276 |
| Molecular Formula | C17H26N6O8S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-amino-4-[[1-[[1-[(1-carboxy-2-hydroxypropyl)amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CS)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H26N6O8S/c1-7(24)13(17(30)31)23-15(28)10(2-8-4-19-6-20-8)21-16(29)11(5-32)22-14(27)9(18)3-12(25)26/h4,6-7,9-11,13,24,32H,2-3,5,18H2,1H3,(H,19,20)(H,21,29)(H,22,27)(H,23,28)(H,25,26)(H,30,31) |
| InChIKey | GLQQAVSTAXCNII-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|