C19H28N8O6S — CID 18257851
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18257851) has the molecular formula C19H28N8O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18257851 |
| Molecular Formula | C19H28N8O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C19H28N8O6S/c1-9(28)15(19(32)33)27-18(31)14(3-11-5-22-8-24-11)26-17(30)13(2-10-4-21-7-23-10)25-16(29)12(20)6-34/h4-5,7-9,12-15,28,34H,2-3,6,20H2,1H3,(H,21,23)(H,22,24)(H,25,29)(H,26,30)(H,27,31)(H,32,33) |
| InChIKey | WHBDLUVVAGGRTB-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 228.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|