C17H27N7O8 — CID 18499061
2-[[4-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18499061) has the molecular formula C17H27N7O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18499061 |
| Molecular Formula | C17H27N7O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C17H27N7O8/c1-7(26)13(24-14(28)9(18)2-8-4-20-6-21-8)16(30)22-10(3-12(19)27)15(29)23-11(5-25)17(31)32/h4,6-7,9-11,13,25-26H,2-3,5,18H2,1H3,(H2,19,27)(H,20,21)(H,22,30)(H,23,29)(H,24,28)(H,31,32) |
| InChIKey | JRGRINKWJZDNDJ-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 262.85 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |