C27H42N8O5 — CID 18307678
2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18307678) has the molecular formula C27H42N8O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18307678 |
| Molecular Formula | C27H42N8O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C27H42N8O5/c28-12-6-4-10-20(30)24(36)34-22(14-18-8-2-1-3-9-18)26(38)33-21(11-5-7-13-29)25(37)35-23(27(39)40)15-19-16-31-17-32-19/h1-3,8-9,16-17,20-23H,4-7,10-15,28-30H2,(H,31,32)(H,33,38)(H,34,36)(H,35,37)(H,39,40) |
| InChIKey | IJOYAKUSVZTWNQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|