C27H41N7O5 — CID 18305741
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18305741) has the molecular formula C27H41N7O5 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18305741 |
| Molecular Formula | C27H41N7O5 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C27H41N7O5/c1-17(2)12-23(27(38)39)34-25(36)21(13-18-8-4-3-5-9-18)33-26(37)22(14-19-15-30-16-31-19)32-24(35)20(29)10-6-7-11-28/h3-5,8-9,15-17,20-23H,6-7,10-14,28-29H2,1-2H3,(H,30,31)(H,32,35)(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | XZKRMJIGHNMYJU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|