C30H39N7O5 — CID 18307717
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18307717) has the molecular formula C30H39N7O5 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18307717 |
| Molecular Formula | C30H39N7O5 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C30H39N7O5/c31-14-8-7-13-23(32)27(38)35-24(15-20-9-3-1-4-10-20)28(39)36-25(16-21-11-5-2-6-12-21)29(40)37-26(30(41)42)17-22-18-33-19-34-22/h1-6,9-12,18-19,23-26H,7-8,13-17,31-32H2,(H,33,34)(H,35,38)(H,36,39)(H,37,40)(H,41,42) |
| InChIKey | YDWMHZHCOYIAAI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|