C25H35N7O7 — CID 18305544
4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18305544) has the molecular formula C25H35N7O7 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18305544 |
| Molecular Formula | C25H35N7O7 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 4-[(1-carboxy-2-phenylethyl)amino]-3-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H35N7O7/c26-9-5-4-8-17(27)22(35)30-18(11-16-13-28-14-29-16)23(36)31-19(12-21(33)34)24(37)32-20(25(38)39)10-15-6-2-1-3-7-15/h1-3,6-7,13-14,17-20H,4-5,8-12,26-27H2,(H,28,29)(H,30,35)(H,31,36)(H,32,37)(H,33,34)(H,38,39) |
| InChIKey | KFPIOLYAPYMLIJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|