C26H39N7O5 — CID 18307837
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18307837) has the molecular formula C26H39N7O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18307837 |
| Molecular Formula | C26H39N7O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H39N7O5/c1-16(2)22(25(36)32-21(26(37)38)13-18-14-29-15-30-18)33-24(35)20(12-17-8-4-3-5-9-17)31-23(34)19(28)10-6-7-11-27/h3-5,8-9,14-16,19-22H,6-7,10-13,27-28H2,1-2H3,(H,29,30)(H,31,34)(H,32,36)(H,33,35)(H,37,38) |
| InChIKey | VTTIFSLNQXZMFK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|