C26H38N8O6 — CID 18307578
2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18307578) has the molecular formula C26H38N8O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18307578 |
| Molecular Formula | C26H38N8O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H38N8O6/c27-11-5-4-8-18(28)23(36)33-20(12-16-6-2-1-3-7-16)25(38)32-19(9-10-22(29)35)24(37)34-21(26(39)40)13-17-14-30-15-31-17/h1-3,6-7,14-15,18-21H,4-5,8-13,27-28H2,(H2,29,35)(H,30,31)(H,32,38)(H,33,36)(H,34,37)(H,39,40) |
| InChIKey | BYBIJHNXWHKXJX-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|