C17H29N7O5S — CID 18257902
2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 18257902) has the molecular formula C17H29N7O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18257902 |
| Molecular Formula | C17H29N7O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H29N7O5S/c18-4-2-1-3-12(16(28)21-7-14(25)26)23-17(29)13(5-10-6-20-9-22-10)24-15(27)11(19)8-30/h6,9,11-13,30H,1-5,7-8,18-19H2,(H,20,22)(H,21,28)(H,23,29)(H,24,27)(H,25,26) |
| InChIKey | YVTQYIOODGBCBY-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|