C18H30N8O6 — CID 22656634
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetic acid (PubChem CID 22656634) has the molecular formula C18H30N8O6 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22656634 |
| Molecular Formula | C18H30N8O6 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H30N8O6/c19-4-2-1-3-12(25-16(30)11(20)6-14(21)27)18(32)26-13(5-10-7-22-9-24-10)17(31)23-8-15(28)29/h7,9,11-13H,1-6,8,19-20H2,(H2,21,27)(H,22,24)(H,23,31)(H,25,30)(H,26,32)(H,28,29) |
| InChIKey | KHNFHZGSPZELTM-UHFFFAOYSA-N |
| XLogP | -3.55 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|