C24H35N7O5S — CID 18497908
6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 18497908) has the molecular formula C24H35N7O5S and a molecular weight of 533.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18497908 |
| Molecular Formula | C24H35N7O5S |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CS)NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C24H35N7O5S/c25-9-5-4-8-18(24(35)36)29-23(34)20(13-37)31-22(33)19(10-15-6-2-1-3-7-15)30-21(32)17(26)11-16-12-27-14-28-16/h1-3,6-7,12,14,17-20,37H,4-5,8-11,13,25-26H2,(H,27,28)(H,29,34)(H,30,32)(H,31,33)(H,35,36) |
| InChIKey | VHNUYUJQEXLXEJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|