C30H39N7O6 — CID 19953454
6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 19953454) has the molecular formula C30H39N7O6 and a molecular weight of 593.69 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19953454 |
| Molecular Formula | C30H39N7O6 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H39N7O6/c31-13-5-4-8-24(30(42)43)35-28(40)25(15-19-6-2-1-3-7-19)37-29(41)26(16-21-17-33-18-34-21)36-27(39)23(32)14-20-9-11-22(38)12-10-20/h1-3,6-7,9-12,17-18,23-26,38H,4-5,8,13-16,31-32H2,(H,33,34)(H,35,40)(H,36,39)(H,37,41)(H,42,43) |
| InChIKey | GODYRDKTVTYBPS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 225.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|