C32H55N9O7 — CID 18364492
2-[2-[[6-amino-2-[[6-amino-2-[[6-amino-2-[(2-amino-3-phenylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]propanoylamino]acetic acid (PubChem CID 18364492) has the molecular formula C32H55N9O7 and a molecular weight of 677.85 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-[[6-amino-2-[[6-amino-2-[(2-amino-3-phenylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]propanoylamino]acetic acid.
| Compound Name | 2-[2-[[6-amino-2-[[6-amino-2-[[6-amino-2-[(2-amino-3-phenylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 18364492 |
| Molecular Formula | C32H55N9O7 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.42 |
| IUPAC Name | 2-[2-[[6-amino-2-[[6-amino-2-[[6-amino-2-[(2-amino-3-phenylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]hexanoyl]amino]propanoylamino]acetic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(N)Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C32H55N9O7/c1-21(28(44)37-20-27(42)43)38-30(46)24(13-5-8-16-33)40-32(48)26(15-7-10-18-35)41-31(47)25(14-6-9-17-34)39-29(45)23(36)19-22-11-3-2-4-12-22/h2-4,11-12,21,23-26H,5-10,13-20,33-36H2,1H3,(H,37,44)(H,38,46)(H,39,45)(H,40,48)(H,41,47)(H,42,43) |
| InChIKey | AHMXGVFQDWGTAK-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 286.88 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|