C21H32Cl2N4O5 — CID 21125762
6-amino-2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one (PubChem CID 21125762) has the molecular formula C21H32Cl2N4O5 and a molecular weight of 491.42 g/mol. Its IUPAC name is 6-amino-2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one.
| Compound Name | 6-amino-2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one |
|---|---|
| PubChem CID | 21125762 |
| Molecular Formula | C21H32Cl2N4O5 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 6-amino-2-[2-[(2-amino-3-phenylpropanoyl)amino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one |
| SMILES | CC(NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C18H28N4O4.C3H4Cl2O/c1-12(16(23)22-15(18(25)26)9-5-6-10-19)21-17(24)14(20)11-13-7-3-2-4-8-13;4-1-3(6)2-5/h2-4,7-8,12,14-15H,5-6,9-11,19-20H2,1H3,(H,21,24)(H,22,23)(H,25,26);1-2H2 |
| InChIKey | PVEPLNLHLFRMNR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|