C31H43N7O7 — CID 46241151
(2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 46241151) has the molecular formula C31H43N7O7 and a molecular weight of 625.73 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 46241151 |
| Molecular Formula | C31H43N7O7 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H43N7O7/c1-19(35-28(41)22(33)16-20-10-4-2-5-11-20)27(40)36-23(14-8-9-15-32)29(42)37-24(18-26(34)39)30(43)38-25(31(44)45)17-21-12-6-3-7-13-21/h2-7,10-13,19,22-25H,8-9,14-18,32-33H2,1H3,(H2,34,39)(H,35,41)(H,36,40)(H,37,42)(H,38,43)(H,44,45)/t19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | HESNIJWWSAZWCP-WIGBTLJFSA-N |
| XLogP | -1.15 |
| TPSA | 248.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|