C24H37N7O7 — CID 18304740
2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18304740) has the molecular formula C24H37N7O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18304740 |
| Molecular Formula | C24H37N7O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H37N7O7/c25-11-5-4-8-15(26)21(34)29-16(9-10-19(27)32)22(35)30-17(13-20(28)33)23(36)31-18(24(37)38)12-14-6-2-1-3-7-14/h1-3,6-7,15-18H,4-5,8-13,25-26H2,(H2,27,32)(H2,28,33)(H,29,34)(H,30,35)(H,31,36)(H,37,38) |
| InChIKey | VDNYZDNPNOWWIN-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|