C26H43N7O6 — CID 18307676
5-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 18307676) has the molecular formula C26H43N7O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is 5-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18307676 |
| Molecular Formula | C26H43N7O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | 5-amino-2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C26H43N7O6/c27-14-6-4-10-18(29)23(35)33-21(16-17-8-2-1-3-9-17)25(37)31-19(11-5-7-15-28)24(36)32-20(26(38)39)12-13-22(30)34/h1-3,8-9,18-21H,4-7,10-16,27-29H2,(H2,30,34)(H,31,37)(H,32,36)(H,33,35)(H,38,39) |
| InChIKey | ZXIWVVZQNSZYEH-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|