C25H39N7O7 — CID 18482086
6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 18482086) has the molecular formula C25H39N7O7 and a molecular weight of 549.63 g/mol. Its IUPAC name is 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18482086 |
| Molecular Formula | C25H39N7O7 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(N)=O)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H39N7O7/c26-13-5-4-8-18(25(38)39)31-23(36)17(10-12-21(29)34)30-24(37)19(14-15-6-2-1-3-7-15)32-22(35)16(27)9-11-20(28)33/h1-3,6-7,16-19H,4-5,8-14,26-27H2,(H2,28,33)(H2,29,34)(H,30,37)(H,31,36)(H,32,35)(H,38,39) |
| InChIKey | IBOIYFNZCWKIEO-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|