C29H40N6O6 — CID 18307583
2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18307583) has the molecular formula C29H40N6O6 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18307583 |
| Molecular Formula | C29H40N6O6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H40N6O6/c30-16-8-7-13-21(31)26(37)34-23(17-19-9-3-1-4-10-19)28(39)33-22(14-15-25(32)36)27(38)35-24(29(40)41)18-20-11-5-2-6-12-20/h1-6,9-12,21-24H,7-8,13-18,30-31H2,(H2,32,36)(H,33,39)(H,34,37)(H,35,38)(H,40,41) |
| InChIKey | BCCSXUZEXNZTTO-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|