C23H36N6O6S — CID 18482046
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 18482046) has the molecular formula C23H36N6O6S and a molecular weight of 524.64 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18482046 |
| Molecular Formula | C23H36N6O6S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CS)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H36N6O6S/c24-11-5-4-8-16(23(34)35)27-22(33)18(13-36)29-21(32)17(12-14-6-2-1-3-7-14)28-20(31)15(25)9-10-19(26)30/h1-3,6-7,15-18,36H,4-5,8-13,24-25H2,(H2,26,30)(H,27,33)(H,28,31)(H,29,32)(H,34,35) |
| InChIKey | BZJNMZQOQOTNOL-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|