C22H34N6O6S — CID 22657356
6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 22657356) has the molecular formula C22H34N6O6S and a molecular weight of 510.62 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22657356 |
| Molecular Formula | C22H34N6O6S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CS)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H34N6O6S/c23-9-5-4-8-15(22(33)34)26-21(32)17(12-35)28-20(31)16(10-13-6-2-1-3-7-13)27-19(30)14(24)11-18(25)29/h1-3,6-7,14-17,35H,4-5,8-12,23-24H2,(H2,25,29)(H,26,32)(H,27,30)(H,28,31)(H,33,34) |
| InChIKey | TUMIAXDJCAOYJZ-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|