C25H40N6O6 — CID 22655941
6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 22655941) has the molecular formula C25H40N6O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22655941 |
| Molecular Formula | C25H40N6O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C25H40N6O6/c1-3-15(2)21(31-22(33)17(27)14-20(28)32)24(35)30-19(13-16-9-5-4-6-10-16)23(34)29-18(25(36)37)11-7-8-12-26/h4-6,9-10,15,17-19,21H,3,7-8,11-14,26-27H2,1-2H3,(H2,28,32)(H,29,34)(H,30,35)(H,31,33)(H,36,37) |
| InChIKey | GJBXHKPTIYFENK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|