C31H51N7O8 — CID 19045046
6-amino-2-[[2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 19045046) has the molecular formula C31H51N7O8 and a molecular weight of 649.79 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19045046 |
| Molecular Formula | C31H51N7O8 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.38 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C31H51N7O8/c1-3-19(2)26(30(44)36-23(31(45)46)14-8-10-16-33)38-28(42)22(13-7-9-15-32)35-29(43)24(17-20-11-5-4-6-12-20)37-27(41)21(34)18-25(39)40/h4-6,11-12,19,21-24,26H,3,7-10,13-18,32-34H2,1-2H3,(H,35,43)(H,36,44)(H,37,41)(H,38,42)(H,39,40)(H,45,46) |
| InChIKey | PZCZBRDEXXDRGZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 269.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|