C22H42N6O6 — CID 22655881
6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 22655881) has the molecular formula C22H42N6O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22655881 |
| Molecular Formula | C22H42N6O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C22H42N6O6/c1-5-13(4)18(28-19(30)14(24)11-17(25)29)21(32)27-16(10-12(2)3)20(31)26-15(22(33)34)8-6-7-9-23/h12-16,18H,5-11,23-24H2,1-4H3,(H2,25,29)(H,26,31)(H,27,32)(H,28,30)(H,33,34) |
| InChIKey | PPUQLABGBOFISF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|