C22H43N7O6 — CID 18303295
6-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 18303295) has the molecular formula C22H43N7O6 and a molecular weight of 501.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18303295 |
| Molecular Formula | C22H43N7O6 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | 6-amino-2-[[2-[[4-amino-2-(2,6-diaminohexanoylamino)-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C22H43N7O6/c1-3-13(2)18(21(33)27-15(22(34)35)9-5-7-11-24)29-20(32)16(12-17(26)30)28-19(31)14(25)8-4-6-10-23/h13-16,18H,3-12,23-25H2,1-2H3,(H2,26,30)(H,27,33)(H,28,31)(H,29,32)(H,34,35) |
| InChIKey | QWZDCNLMTONIOJ-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|