C21H38N6O8 — CID 22655781
6-amino-2-[[4-carboxy-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]butanoyl]amino]hexanoic acid (PubChem CID 22655781) has the molecular formula C21H38N6O8 and a molecular weight of 502.57 g/mol. Its IUPAC name is 6-amino-2-[[4-carboxy-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]butanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-carboxy-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22655781 |
| Molecular Formula | C21H38N6O8 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 6-amino-2-[[4-carboxy-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylpentanoyl]amino]butanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H38N6O8/c1-3-11(2)17(27-18(31)12(23)10-15(24)28)20(33)25-13(7-8-16(29)30)19(32)26-14(21(34)35)6-4-5-9-22/h11-14,17H,3-10,22-23H2,1-2H3,(H2,24,28)(H,25,33)(H,26,32)(H,27,31)(H,29,30)(H,34,35) |
| InChIKey | HRYCSTVOIMPETN-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|