C23H45N7O6 — CID 18481346
6-amino-2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 18481346) has the molecular formula C23H45N7O6 and a molecular weight of 515.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18481346 |
| Molecular Formula | C23H45N7O6 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C23H45N7O6/c1-3-14(2)19(22(34)29-17(23(35)36)9-5-7-13-25)30-21(33)16(8-4-6-12-24)28-20(32)15(26)10-11-18(27)31/h14-17,19H,3-13,24-26H2,1-2H3,(H2,27,31)(H,28,32)(H,29,34)(H,30,33)(H,35,36) |
| InChIKey | NUGOCFKDBFOALS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|