C20H38N6O6S — CID 18304871
2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18304871) has the molecular formula C20H38N6O6S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18304871 |
| Molecular Formula | C20H38N6O6S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(N)=O)NC(=O)C(N)CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C20H38N6O6S/c1-3-11(2)16(19(30)25-14(10-33)20(31)32)26-18(29)13(7-8-15(23)27)24-17(28)12(22)6-4-5-9-21/h11-14,16,33H,3-10,21-22H2,1-2H3,(H2,23,27)(H,24,28)(H,25,30)(H,26,29)(H,31,32) |
| InChIKey | IJUXESJWVJEEJA-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|