C22H41N5O7 — CID 22706242
2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 22706242) has the molecular formula C22H41N5O7 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22706242 |
| Molecular Formula | C22H41N5O7 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H41N5O7/c1-5-13(4)18(27-19(30)14(24)10-12(2)3)21(32)25-15(8-6-7-9-23)20(31)26-16(22(33)34)11-17(28)29/h12-16,18H,5-11,23-24H2,1-4H3,(H,25,32)(H,26,31)(H,27,30)(H,28,29)(H,33,34) |
| InChIKey | DBGFLHCZWFTPOO-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|