C20H39N5O5 — CID 22706246
2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 22706246) has the molecular formula C20H39N5O5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22706246 |
| Molecular Formula | C20H39N5O5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(C)C)C(=O)NC(CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H39N5O5/c1-5-13(4)17(25-18(28)14(22)10-12(2)3)20(30)24-15(8-6-7-9-21)19(29)23-11-16(26)27/h12-15,17H,5-11,21-22H2,1-4H3,(H,23,29)(H,24,30)(H,25,28)(H,26,27) |
| InChIKey | VBAFCGIAONSMTI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|