C24H38N6O6 — CID 22659890
2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 22659890) has the molecular formula C24H38N6O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22659890 |
| Molecular Formula | C24H38N6O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-methylbutanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CC(N)=O)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H38N6O6/c1-14(2)20(30-21(32)16(26)13-19(27)31)23(34)28-17(10-6-7-11-25)22(33)29-18(24(35)36)12-15-8-4-3-5-9-15/h3-5,8-9,14,16-18,20H,6-7,10-13,25-26H2,1-2H3,(H2,27,31)(H,28,34)(H,29,33)(H,30,32)(H,35,36) |
| InChIKey | HQZILARYPQITJX-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|