C24H38N6O6S2 — CID 88726591
(2S)-2-[[(2R)-6-amino-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 88726591) has the molecular formula C24H38N6O6S2 and a molecular weight of 570.74 g/mol. Its IUPAC name is (2S)-2-[[(2R)-6-amino-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2R)-6-amino-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 88726591 |
| Molecular Formula | C24H38N6O6S2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (2S)-2-[[(2R)-6-amino-2-[[(2R)-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@@H](CS)C(=O)N[C@H](CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H38N6O6S2/c1-14(27-21(32)16(26)12-37)20(31)30-19(13-38)23(34)28-17(9-5-6-10-25)22(33)29-18(24(35)36)11-15-7-3-2-4-8-15/h2-4,7-8,14,16-19,37-38H,5-6,9-13,25-26H2,1H3,(H,27,32)(H,28,34)(H,29,33)(H,30,31)(H,35,36)/t14-,16-,17+,18-,19-/m0/s1 |
| InChIKey | MHVSNYYPBBNDTH-UJCHZGTJSA-N |
| XLogP | -1.41 |
| TPSA | 205.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|