C22H35N5O6S — CID 18749752
2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18749752) has the molecular formula C22H35N5O6S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18749752 |
| Molecular Formula | C22H35N5O6S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C22H35N5O6S/c1-13(28)18(24)21(31)25-15(9-5-6-10-23)19(29)26-16(11-14-7-3-2-4-8-14)20(30)27-17(12-34)22(32)33/h2-4,7-8,13,15-18,28,34H,5-6,9-12,23-24H2,1H3,(H,25,31)(H,26,29)(H,27,30)(H,32,33) |
| InChIKey | DLWBMSXBLUAABA-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|