C25H41N5O6 — CID 18750517
2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid (PubChem CID 18750517) has the molecular formula C25H41N5O6 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18750517 |
| Molecular Formula | C25H41N5O6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(Cc1ccccc1)NC(=O)C(N)C(C)O)C(=O)O |
| InChI | InChI=1S/C25H41N5O6/c1-15(2)13-20(25(35)36)30-22(32)18(11-7-8-12-26)28-23(33)19(14-17-9-5-4-6-10-17)29-24(34)21(27)16(3)31/h4-6,9-10,15-16,18-21,31H,7-8,11-14,26-27H2,1-3H3,(H,28,33)(H,29,34)(H,30,32)(H,35,36) |
| InChIKey | ZMMPRLVBJNQSKK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|