C24H38N6O7 — CID 18749754
5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18749754) has the molecular formula C24H38N6O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18749754 |
| Molecular Formula | C24H38N6O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H38N6O7/c1-14(31)20(27)23(35)28-16(9-5-6-12-25)21(33)30-18(13-15-7-3-2-4-8-15)22(34)29-17(24(36)37)10-11-19(26)32/h2-4,7-8,14,16-18,20,31H,5-6,9-13,25,27H2,1H3,(H2,26,32)(H,28,35)(H,29,34)(H,30,33)(H,36,37) |
| InChIKey | RYAFFRCTPDOVHT-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|