C24H38N6O8 — CID 18749853
5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18749853) has the molecular formula C24H38N6O8 and a molecular weight of 538.60 g/mol. Its IUPAC name is 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18749853 |
| Molecular Formula | C24H38N6O8 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H38N6O8/c1-13(31)20(27)23(36)28-16(4-2-3-11-25)21(34)30-18(12-14-5-7-15(32)8-6-14)22(35)29-17(24(37)38)9-10-19(26)33/h5-8,13,16-18,20,31-32H,2-4,9-12,25,27H2,1H3,(H2,26,33)(H,28,36)(H,29,35)(H,30,34)(H,37,38) |
| InChIKey | NQFBJWFGVDSYMU-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|